C28H36N8O2 — CID 163269536
7-(3-amino-2-methanimidoylphenyl)-2-[1-(dimethylamino)propan-2-yloxy]-4-(4-prop-2-enoylpiperazin-1-yl)-6,8-dihydro-5H-1,7-naphthyridine-3-carbonitrile (PubChem CID 163269536) has the molecular formula C28H36N8O2 and a molecular weight of 516.65 g/mol. Its IUPAC name is 7-(3-amino-2-methanimidoylphenyl)-2-[1-(dimethylamino)propan-2-yloxy]-4-(4-prop-2-enoylpiperazin-1-yl)-6,8-dihydro-5H-1,7-naphthyridine-3-carbonitrile.
| Compound Name | 7-(3-amino-2-methanimidoylphenyl)-2-[1-(dimethylamino)propan-2-yloxy]-4-(4-prop-2-enoylpiperazin-1-yl)-6,8-dihydro-5H-1,7-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 163269536 |
| Molecular Formula | C28H36N8O2 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.30 |
| IUPAC Name | 7-(3-amino-2-methanimidoylphenyl)-2-[1-(dimethylamino)propan-2-yloxy]-4-(4-prop-2-enoylpiperazin-1-yl)-6,8-dihydro-5H-1,7-naphthyridine-3-carbonitrile |
| SMILES | [H]/N=C/c1c(N)cccc1N1CCc2c(nc(OC(C)CN(C)C)c(C#N)c2N2CCN(C(=O)C=C)CC2)C1 |
| InChI | InChI=1S/C28H36N8O2/c1-5-26(37)34-11-13-35(14-12-34)27-20-9-10-36(25-8-6-7-23(31)21(25)15-29)18-24(20)32-28(22(27)16-30)38-19(2)17-33(3)4/h5-8,15,19,29H,1,9-14,17-18,31H2,2-4H3/b29-15+ |
| InChIKey | WBJXGTKIZHRMFF-WKULSOCRSA-N |
| XLogP | 2.26 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|