About 4-ethenyl-N,N-dimethyl-5-(methylideneamino)pyridin-3-amine
4-ethenyl-N,N-dimethyl-5-(methylideneamino)pyridin-3-amine (PubChem CID 163269559) has the molecular formula C10H13N3
and a molecular weight of 175.23 g/mol. Its IUPAC name is 4-ethenyl-N,N-dimethyl-5-(methylideneamino)pyridin-3-amine.
Molecular Properties
| Compound Name | 4-ethenyl-N,N-dimethyl-5-(methylideneamino)pyridin-3-amine |
| PubChem CID | 163269559 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 4-ethenyl-N,N-dimethyl-5-(methylideneamino)pyridin-3-amine |
| SMILES | C=Cc1c(N=C)cncc1N(C)C |
| InChI | InChI=1S/C10H13N3/c1-5-8-9(11-2)6-12-7-10(8)13(3)4/h5-7H,1-2H2,3-4H3 |
| InChIKey | LAGRCDFVORNARL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenyl-N,N-dimethyl-5-(methylideneamino)pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-N,N-dimethyl-5-(methylideneamino)pyridin-3-amine?
The IUPAC name of 4-ethenyl-N,N-dimethyl-5-(methylideneamino)pyridin-3-amine (CID 163269559) is 4-ethenyl-N,N-dimethyl-5-(methylideneamino)pyridin-3-amine.
What is the SMILES notation for 4-ethenyl-N,N-dimethyl-5-(methylideneamino)pyridin-3-amine?
The canonical SMILES for 4-ethenyl-N,N-dimethyl-5-(methylideneamino)pyridin-3-amine is C=Cc1c(N=C)cncc1N(C)C.
What is the InChIKey of 4-ethenyl-N,N-dimethyl-5-(methylideneamino)pyridin-3-amine?
The InChIKey is LAGRCDFVORNARL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c1-5-8-9(11-2)6-12-7-10(8)13(3)4/h5-7H,1-2H2,3-4H3.
What are the key properties of 4-ethenyl-N,N-dimethyl-5-(methylideneamino)pyridin-3-amine?
4-ethenyl-N,N-dimethyl-5-(methylideneamino)pyridin-3-amine has a molecular weight of 175.23 g/mol, XLogP of 2.12, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-N,N-dimethyl-5-(methylideneamino)pyridin-3-amine is sourced from PubChem (CID 163269559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).