About 7-(3-cyclohexa-1,5-dien-1-ylpropylsulfanyl)heptanamide;formaldehyde;molecular hydrogen
7-(3-cyclohexa-1,5-dien-1-ylpropylsulfanyl)heptanamide;formaldehyde;molecular hydrogen (PubChem CID 163270044) has the molecular formula C17H31NO2S
and a molecular weight of 313.51 g/mol. Its IUPAC name is 7-(3-cyclohexa-1,5-dien-1-ylpropylsulfanyl)heptanamide;formaldehyde;molecular hydrogen.
Molecular Properties
| Compound Name | 7-(3-cyclohexa-1,5-dien-1-ylpropylsulfanyl)heptanamide;formaldehyde;molecular hydrogen |
| PubChem CID | 163270044 |
| Molecular Formula | C17H31NO2S |
| Molecular Weight | 313.51 g/mol |
| Exact Mass | 313.21 |
| IUPAC Name | 7-(3-cyclohexa-1,5-dien-1-ylpropylsulfanyl)heptanamide;formaldehyde;molecular hydrogen |
| SMILES | C=O.NC(=O)CCCCCCSCCCC1=CCCC=C1.[H][H] |
| InChI | InChI=1S/C16H27NOS.CH2O.H2/c17-16(18)12-6-1-2-7-13-19-14-8-11-15-9-4-3-5-10-15;1-2;/h4,9-10H,1-3,5-8,11-14H2,(H2,17,18);1H2;1H |
| InChIKey | BTYSMQNFNRGQMY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-(3-cyclohexa-1,5-dien-1-ylpropylsulfanyl)heptanamide;formaldehyde;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3-cyclohexa-1,5-dien-1-ylpropylsulfanyl)heptanamide;formaldehyde;molecular hydrogen?
The IUPAC name of 7-(3-cyclohexa-1,5-dien-1-ylpropylsulfanyl)heptanamide;formaldehyde;molecular hydrogen (CID 163270044) is 7-(3-cyclohexa-1,5-dien-1-ylpropylsulfanyl)heptanamide;formaldehyde;molecular hydrogen.
What is the SMILES notation for 7-(3-cyclohexa-1,5-dien-1-ylpropylsulfanyl)heptanamide;formaldehyde;molecular hydrogen?
The canonical SMILES for 7-(3-cyclohexa-1,5-dien-1-ylpropylsulfanyl)heptanamide;formaldehyde;molecular hydrogen is C=O.NC(=O)CCCCCCSCCCC1=CCCC=C1.[H][H].
What is the InChIKey of 7-(3-cyclohexa-1,5-dien-1-ylpropylsulfanyl)heptanamide;formaldehyde;molecular hydrogen?
The InChIKey is BTYSMQNFNRGQMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NOS.CH2O.H2/c17-16(18)12-6-1-2-7-13-19-14-8-11-15-9-4-3-5-10-15;1-2;/h4,9-10H,1-3,5-8,11-14H2,(H2,17,18);1H2;1H.
What are the key properties of 7-(3-cyclohexa-1,5-dien-1-ylpropylsulfanyl)heptanamide;formaldehyde;molecular hydrogen?
7-(3-cyclohexa-1,5-dien-1-ylpropylsulfanyl)heptanamide;formaldehyde;molecular hydrogen has a molecular weight of 313.51 g/mol, XLogP of 4.27, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3-cyclohexa-1,5-dien-1-ylpropylsulfanyl)heptanamide;formaldehyde;molecular hydrogen is sourced from PubChem (CID 163270044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).