C30H38N8O2 — CID 163270538
2-[4-[7-(2,3-dihydro-1,4-benzoxazin-4-yl)-2-[3-(dimethylamino)azetidin-1-yl]-5,6,7,8-tetrahydroquinazolin-4-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile (PubChem CID 163270538) has the molecular formula C30H38N8O2 and a molecular weight of 542.69 g/mol. Its IUPAC name is 2-[4-[7-(2,3-dihydro-1,4-benzoxazin-4-yl)-2-[3-(dimethylamino)azetidin-1-yl]-5,6,7,8-tetrahydroquinazolin-4-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile.
| Compound Name | 2-[4-[7-(2,3-dihydro-1,4-benzoxazin-4-yl)-2-[3-(dimethylamino)azetidin-1-yl]-5,6,7,8-tetrahydroquinazolin-4-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 163270538 |
| Molecular Formula | C30H38N8O2 |
| Molecular Weight | 542.69 g/mol |
| Exact Mass | 542.31 |
| IUPAC Name | 2-[4-[7-(2,3-dihydro-1,4-benzoxazin-4-yl)-2-[3-(dimethylamino)azetidin-1-yl]-5,6,7,8-tetrahydroquinazolin-4-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile |
| SMILES | C=CC(=O)N1CCN(c2nc(N3CC(N(C)C)C3)nc3c2CCC(N2CCOc4ccccc42)C3)CC1CC#N |
| InChI | InChI=1S/C30H38N8O2/c1-4-28(39)38-14-13-35(18-22(38)11-12-31)29-24-10-9-21(37-15-16-40-27-8-6-5-7-26(27)37)17-25(24)32-30(33-29)36-19-23(20-36)34(2)3/h4-8,21-23H,1,9-11,13-20H2,2-3H3 |
| InChIKey | UMNAUIJVQLCQLZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 92.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.69 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|