About cesium;carbanide;1-methyl-2-(prop-1-en-2-yloxymethyl)pyrrolidine
cesium;carbanide;1-methyl-2-(prop-1-en-2-yloxymethyl)pyrrolidine (PubChem CID 163270622) has the molecular formula C10H20CsNO
and a molecular weight of 303.18 g/mol. Its IUPAC name is cesium;carbanide;1-methyl-2-(prop-1-en-2-yloxymethyl)pyrrolidine.
Molecular Properties
| Compound Name | cesium;carbanide;1-methyl-2-(prop-1-en-2-yloxymethyl)pyrrolidine |
| PubChem CID | 163270622 |
| Molecular Formula | C10H20CsNO |
| Molecular Weight | 303.18 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | cesium;carbanide;1-methyl-2-(prop-1-en-2-yloxymethyl)pyrrolidine |
| SMILES | C=C(C)OCC1CCCN1C.[CH3-].[Cs+] |
| InChI | InChI=1S/C9H17NO.CH3.Cs/c1-8(2)11-7-9-5-4-6-10(9)3;;/h9H,1,4-7H2,2-3H3;1H3;/q;-1;+1 |
| InChIKey | NVPCFZZICJYFID-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.18 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cesium;carbanide;1-methyl-2-(prop-1-en-2-yloxymethyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cesium;carbanide;1-methyl-2-(prop-1-en-2-yloxymethyl)pyrrolidine?
The IUPAC name of cesium;carbanide;1-methyl-2-(prop-1-en-2-yloxymethyl)pyrrolidine (CID 163270622) is cesium;carbanide;1-methyl-2-(prop-1-en-2-yloxymethyl)pyrrolidine.
What is the SMILES notation for cesium;carbanide;1-methyl-2-(prop-1-en-2-yloxymethyl)pyrrolidine?
The canonical SMILES for cesium;carbanide;1-methyl-2-(prop-1-en-2-yloxymethyl)pyrrolidine is C=C(C)OCC1CCCN1C.[CH3-].[Cs+].
What is the InChIKey of cesium;carbanide;1-methyl-2-(prop-1-en-2-yloxymethyl)pyrrolidine?
The InChIKey is NVPCFZZICJYFID-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO.CH3.Cs/c1-8(2)11-7-9-5-4-6-10(9)3;;/h9H,1,4-7H2,2-3H3;1H3;/q;-1;+1.
What are the key properties of cesium;carbanide;1-methyl-2-(prop-1-en-2-yloxymethyl)pyrrolidine?
cesium;carbanide;1-methyl-2-(prop-1-en-2-yloxymethyl)pyrrolidine has a molecular weight of 303.18 g/mol, XLogP of -0.91, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cesium;carbanide;1-methyl-2-(prop-1-en-2-yloxymethyl)pyrrolidine is sourced from PubChem (CID 163270622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).