C20H21F3N6O2S2 — CID 163270999
N-cyclopropylsulfanyl-2-(methylaminomethyl)pyridin-4-amine;5-[6-(2,2,2-trifluoroethoxy)pyrazin-2-yl]-1,3-thiazole-2-carbaldehyde (PubChem CID 163270999) has the molecular formula C20H21F3N6O2S2 and a molecular weight of 498.56 g/mol. Its IUPAC name is N-cyclopropylsulfanyl-2-(methylaminomethyl)pyridin-4-amine;5-[6-(2,2,2-trifluoroethoxy)pyrazin-2-yl]-1,3-thiazole-2-carbaldehyde.
| Compound Name | N-cyclopropylsulfanyl-2-(methylaminomethyl)pyridin-4-amine;5-[6-(2,2,2-trifluoroethoxy)pyrazin-2-yl]-1,3-thiazole-2-carbaldehyde |
|---|---|
| PubChem CID | 163270999 |
| Molecular Formula | C20H21F3N6O2S2 |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | N-cyclopropylsulfanyl-2-(methylaminomethyl)pyridin-4-amine;5-[6-(2,2,2-trifluoroethoxy)pyrazin-2-yl]-1,3-thiazole-2-carbaldehyde |
| SMILES | CNCc1cc(NSC2CC2)ccn1.O=Cc1ncc(-c2cncc(OCC(F)(F)F)n2)s1 |
| InChI | InChI=1S/C10H6F3N3O2S.C10H15N3S/c11-10(12,13)5-18-8-3-14-1-6(16-8)7-2-15-9(4-17)19-7;1-11-7-9-6-8(4-5-12-9)13-14-10-2-3-10/h1-4H,5H2;4-6,10-11H,2-3,7H2,1H3,(H,12,13) |
| InChIKey | XXHZASZRTYLGIE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 101.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|