About 1,4-dimethylpiperidine;2-methyl-N-(2-methylpropyl)propanamide
1,4-dimethylpiperidine;2-methyl-N-(2-methylpropyl)propanamide (PubChem CID 163271115) has the molecular formula C15H32N2O
and a molecular weight of 256.43 g/mol. Its IUPAC name is 1,4-dimethylpiperidine;2-methyl-N-(2-methylpropyl)propanamide.
Molecular Properties
| Compound Name | 1,4-dimethylpiperidine;2-methyl-N-(2-methylpropyl)propanamide |
| PubChem CID | 163271115 |
| Molecular Formula | C15H32N2O |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.25 |
| IUPAC Name | 1,4-dimethylpiperidine;2-methyl-N-(2-methylpropyl)propanamide |
| SMILES | CC(C)CNC(=O)C(C)C.CC1CCN(C)CC1 |
| InChI | InChI=1S/C8H17NO.C7H15N/c1-6(2)5-9-8(10)7(3)4;1-7-3-5-8(2)6-4-7/h6-7H,5H2,1-4H3,(H,9,10);7H,3-6H2,1-2H3 |
| InChIKey | PBGYPFLPQXOMAG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-dimethylpiperidine;2-methyl-N-(2-methylpropyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethylpiperidine;2-methyl-N-(2-methylpropyl)propanamide?
The IUPAC name of 1,4-dimethylpiperidine;2-methyl-N-(2-methylpropyl)propanamide (CID 163271115) is 1,4-dimethylpiperidine;2-methyl-N-(2-methylpropyl)propanamide.
What is the SMILES notation for 1,4-dimethylpiperidine;2-methyl-N-(2-methylpropyl)propanamide?
The canonical SMILES for 1,4-dimethylpiperidine;2-methyl-N-(2-methylpropyl)propanamide is CC(C)CNC(=O)C(C)C.CC1CCN(C)CC1.
What is the InChIKey of 1,4-dimethylpiperidine;2-methyl-N-(2-methylpropyl)propanamide?
The InChIKey is PBGYPFLPQXOMAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO.C7H15N/c1-6(2)5-9-8(10)7(3)4;1-7-3-5-8(2)6-4-7/h6-7H,5H2,1-4H3,(H,9,10);7H,3-6H2,1-2H3.
What are the key properties of 1,4-dimethylpiperidine;2-methyl-N-(2-methylpropyl)propanamide?
1,4-dimethylpiperidine;2-methyl-N-(2-methylpropyl)propanamide has a molecular weight of 256.43 g/mol, XLogP of 2.76, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethylpiperidine;2-methyl-N-(2-methylpropyl)propanamide is sourced from PubChem (CID 163271115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).