C20H19F2N5O2S2 — CID 163271406
N-[[5-(cyclopropylsulfanylamino)-2,3-difluorophenyl]methyl]-5-(6-ethoxypyrazin-2-yl)-1,3-thiazole-2-carboxamide (PubChem CID 163271406) has the molecular formula C20H19F2N5O2S2 and a molecular weight of 463.54 g/mol. Its IUPAC name is N-[[5-(cyclopropylsulfanylamino)-2,3-difluorophenyl]methyl]-5-(6-ethoxypyrazin-2-yl)-1,3-thiazole-2-carboxamide.
| Compound Name | N-[[5-(cyclopropylsulfanylamino)-2,3-difluorophenyl]methyl]-5-(6-ethoxypyrazin-2-yl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 163271406 |
| Molecular Formula | C20H19F2N5O2S2 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | N-[[5-(cyclopropylsulfanylamino)-2,3-difluorophenyl]methyl]-5-(6-ethoxypyrazin-2-yl)-1,3-thiazole-2-carboxamide |
| SMILES | CCOc1cncc(-c2cnc(C(=O)NCc3cc(NSC4CC4)cc(F)c3F)s2)n1 |
| InChI | InChI=1S/C20H19F2N5O2S2/c1-2-29-17-10-23-8-15(26-17)16-9-25-20(30-16)19(28)24-7-11-5-12(6-14(21)18(11)22)27-31-13-3-4-13/h5-6,8-10,13,27H,2-4,7H2,1H3,(H,24,28) |
| InChIKey | VRAVPTPOJOHBKH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|