C15H32N2O2 — CID 163271749
ethane;N-[1-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)propan-2-yl]propanamide (PubChem CID 163271749) has the molecular formula C15H32N2O2 and a molecular weight of 272.43 g/mol. Its IUPAC name is ethane;N-[1-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)propan-2-yl]propanamide.
| Compound Name | ethane;N-[1-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)propan-2-yl]propanamide |
|---|---|
| PubChem CID | 163271749 |
| Molecular Formula | C15H32N2O2 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | ethane;N-[1-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)propan-2-yl]propanamide |
| SMILES | CC.CC.CCC(=O)NC(C)CN1CC2CC1CO2 |
| InChI | InChI=1S/C11H20N2O2.2C2H6/c1-3-11(14)12-8(2)5-13-6-10-4-9(13)7-15-10;2*1-2/h8-10H,3-7H2,1-2H3,(H,12,14);2*1-2H3 |
| InChIKey | BBWHERBPMZQAEJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |