C34H25F5N6O3 — CID 163272205
4-[(2,4-dimethoxyphenyl)methylamino]-N-[6-methyl-1-(2,3,4,5,6-pentafluoroanilino)isoquinolin-5-yl]quinazoline-8-carboxamide (PubChem CID 163272205) has the molecular formula C34H25F5N6O3 and a molecular weight of 660.60 g/mol. Its IUPAC name is 4-[(2,4-dimethoxyphenyl)methylamino]-N-[6-methyl-1-(2,3,4,5,6-pentafluoroanilino)isoquinolin-5-yl]quinazoline-8-carboxamide.
| Compound Name | 4-[(2,4-dimethoxyphenyl)methylamino]-N-[6-methyl-1-(2,3,4,5,6-pentafluoroanilino)isoquinolin-5-yl]quinazoline-8-carboxamide |
|---|---|
| PubChem CID | 163272205 |
| Molecular Formula | C34H25F5N6O3 |
| Molecular Weight | 660.60 g/mol |
| Exact Mass | 660.19 |
| IUPAC Name | 4-[(2,4-dimethoxyphenyl)methylamino]-N-[6-methyl-1-(2,3,4,5,6-pentafluoroanilino)isoquinolin-5-yl]quinazoline-8-carboxamide |
| SMILES | COc1ccc(CNc2ncnc3c(C(=O)Nc4c(C)ccc5c(Nc6c(F)c(F)c(F)c(F)c6F)nccc45)cccc23)c(OC)c1 |
| InChI | InChI=1S/C34H25F5N6O3/c1-16-7-10-20-19(11-12-40-33(20)44-31-27(38)25(36)24(35)26(37)28(31)39)29(16)45-34(46)22-6-4-5-21-30(22)42-15-43-32(21)41-14-17-8-9-18(47-2)13-23(17)48-3/h4-13,15H,14H2,1-3H3,(H,40,44)(H,45,46)(H,41,42,43) |
| InChIKey | LNBCCKUEFBKTFM-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.60 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|