C34H27F3N6O3 — CID 163272290
4-[(2,4-dimethoxyphenyl)methylamino]-N-[6-methyl-1-(2,4,5-trifluoroanilino)isoquinolin-5-yl]quinazoline-8-carboxamide (PubChem CID 163272290) has the molecular formula C34H27F3N6O3 and a molecular weight of 624.62 g/mol. Its IUPAC name is 4-[(2,4-dimethoxyphenyl)methylamino]-N-[6-methyl-1-(2,4,5-trifluoroanilino)isoquinolin-5-yl]quinazoline-8-carboxamide.
| Compound Name | 4-[(2,4-dimethoxyphenyl)methylamino]-N-[6-methyl-1-(2,4,5-trifluoroanilino)isoquinolin-5-yl]quinazoline-8-carboxamide |
|---|---|
| PubChem CID | 163272290 |
| Molecular Formula | C34H27F3N6O3 |
| Molecular Weight | 624.62 g/mol |
| Exact Mass | 624.21 |
| IUPAC Name | 4-[(2,4-dimethoxyphenyl)methylamino]-N-[6-methyl-1-(2,4,5-trifluoroanilino)isoquinolin-5-yl]quinazoline-8-carboxamide |
| SMILES | COc1ccc(CNc2ncnc3c(C(=O)Nc4c(C)ccc5c(Nc6cc(F)c(F)cc6F)nccc45)cccc23)c(OC)c1 |
| InChI | InChI=1S/C34H27F3N6O3/c1-18-7-10-22-21(11-12-38-33(22)42-28-15-26(36)25(35)14-27(28)37)30(18)43-34(44)24-6-4-5-23-31(24)40-17-41-32(23)39-16-19-8-9-20(45-2)13-29(19)46-3/h4-15,17H,16H2,1-3H3,(H,38,42)(H,43,44)(H,39,40,41) |
| InChIKey | YDGQAAGNZGCGKH-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.62 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|