C30H31N5O6 — CID 163272648
(2S,3R,4S,5S,6R)-6-(4-azidophenyl)-10,12-dimethoxy-4-(2-oxa-6-azaspiro[3.3]heptan-6-ylmethyl)-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-2,3-diol (PubChem CID 163272648) has the molecular formula C30H31N5O6 and a molecular weight of 557.61 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-6-(4-azidophenyl)-10,12-dimethoxy-4-(2-oxa-6-azaspiro[3.3]heptan-6-ylmethyl)-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-2,3-diol.
| Compound Name | (2S,3R,4S,5S,6R)-6-(4-azidophenyl)-10,12-dimethoxy-4-(2-oxa-6-azaspiro[3.3]heptan-6-ylmethyl)-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-2,3-diol |
|---|---|
| PubChem CID | 163272648 |
| Molecular Formula | C30H31N5O6 |
| Molecular Weight | 557.61 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | (2S,3R,4S,5S,6R)-6-(4-azidophenyl)-10,12-dimethoxy-4-(2-oxa-6-azaspiro[3.3]heptan-6-ylmethyl)-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-2,3-diol |
| SMILES | COc1cc2c(c(OC)n1)[C@]1(O)[C@H](O)[C@H](CN3CC4(COC4)C3)[C@@H](c3ccccc3)[C@]1(c1ccc(N=[N+]=[N-])cc1)O2 |
| InChI | InChI=1S/C30H31N5O6/c1-38-23-12-22-25(27(32-23)39-2)29(37)26(36)21(13-35-14-28(15-35)16-40-17-28)24(18-6-4-3-5-7-18)30(29,41-22)19-8-10-20(11-9-19)33-34-31/h3-12,21,24,26,36-37H,13-17H2,1-2H3/t21-,24-,26-,29+,30+/m1/s1 |
| InChIKey | UXBNUAHWWDXXRC-JAQSATLNSA-N |
| XLogP | 3.62 |
| TPSA | 142.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.61 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|