C15H17F3INO2S2 — CID 163273160
2-[4-methoxy-3-[methyl-[3-(2,2,2-trifluoroethoxysulfanyl)propyl]amino]phenyl]ethynyl thiohypoiodite (PubChem CID 163273160) has the molecular formula C15H17F3INO2S2 and a molecular weight of 491.34 g/mol. Its IUPAC name is 2-[4-methoxy-3-[methyl-[3-(2,2,2-trifluoroethoxysulfanyl)propyl]amino]phenyl]ethynyl thiohypoiodite.
| Compound Name | 2-[4-methoxy-3-[methyl-[3-(2,2,2-trifluoroethoxysulfanyl)propyl]amino]phenyl]ethynyl thiohypoiodite |
|---|---|
| PubChem CID | 163273160 |
| Molecular Formula | C15H17F3INO2S2 |
| Molecular Weight | 491.34 g/mol |
| Exact Mass | 490.97 |
| IUPAC Name | 2-[4-methoxy-3-[methyl-[3-(2,2,2-trifluoroethoxysulfanyl)propyl]amino]phenyl]ethynyl thiohypoiodite |
| SMILES | COc1ccc(C#CSI)cc1N(C)CCCSOCC(F)(F)F |
| InChI | InChI=1S/C15H17F3INO2S2/c1-20(7-3-8-24-22-11-15(16,17)18)13-10-12(6-9-23-19)4-5-14(13)21-2/h4-5,10H,3,7-8,11H2,1-2H3 |
| InChIKey | ZVGKOTOMFLSPIO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.34 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|