C8H7Cl2N3 — CID 163273340
4,6-dichloro-1,2-dimethylimidazo[4,5-c]pyridine (PubChem CID 163273340) has the molecular formula C8H7Cl2N3 and a molecular weight of 216.07 g/mol. Its IUPAC name is 4,6-dichloro-1,2-dimethylimidazo[4,5-c]pyridine.
| Compound Name | 4,6-dichloro-1,2-dimethylimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 163273340 |
| Molecular Formula | C8H7Cl2N3 |
| Molecular Weight | 216.07 g/mol |
| Exact Mass | 215.00 |
| IUPAC Name | 4,6-dichloro-1,2-dimethylimidazo[4,5-c]pyridine |
| SMILES | Cc1nc2c(Cl)nc(Cl)cc2n1C |
| InChI | InChI=1S/C8H7Cl2N3/c1-4-11-7-5(13(4)2)3-6(9)12-8(7)10/h3H,1-2H3 |
| InChIKey | YCAFVTDCYUYHSF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.07 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|