C22H21N3O5 — CID 163274025
4-[5-(2,6-dimethoxyphenoxy)-1-methyl-2-oxo-4-pyridinyl]-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one (PubChem CID 163274025) has the molecular formula C22H21N3O5 and a molecular weight of 407.43 g/mol. Its IUPAC name is 4-[5-(2,6-dimethoxyphenoxy)-1-methyl-2-oxo-4-pyridinyl]-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one.
| Compound Name | 4-[5-(2,6-dimethoxyphenoxy)-1-methyl-2-oxo-4-pyridinyl]-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 163274025 |
| Molecular Formula | C22H21N3O5 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 4-[5-(2,6-dimethoxyphenoxy)-1-methyl-2-oxo-4-pyridinyl]-6-methyl-1H-pyrrolo[2,3-c]pyridin-7-one |
| SMILES | COc1cccc(OC)c1Oc1cn(C)c(=O)cc1-c1cn(C)c(=O)c2[nH]ccc12 |
| InChI | InChI=1S/C22H21N3O5/c1-24-12-18(30-21-16(28-3)6-5-7-17(21)29-4)14(10-19(24)26)15-11-25(2)22(27)20-13(15)8-9-23-20/h5-12,23H,1-4H3 |
| InChIKey | ZXGZSAHHISFZCH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|