About (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutanoic acid
(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutanoic acid (PubChem CID 163274361) has the molecular formula C10H19F3O3Si
and a molecular weight of 272.34 g/mol. Its IUPAC name is (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutanoic acid.
Molecular Properties
| Compound Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutanoic acid |
| PubChem CID | 163274361 |
| Molecular Formula | C10H19F3O3Si |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CC(=O)O)C(F)(F)F |
| InChI | InChI=1S/C10H19F3O3Si/c1-9(2,3)17(4,5)16-7(6-8(14)15)10(11,12)13/h7H,6H2,1-5H3,(H,14,15)/t7-/m0/s1 |
| InChIKey | BGJDPFGQRMYAEE-ZETCQYMHSA-N |
| XLogP | 3.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutanoic acid?
The IUPAC name of (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutanoic acid (CID 163274361) is (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutanoic acid.
What is the SMILES notation for (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutanoic acid?
The canonical SMILES for (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutanoic acid is CC(C)(C)[Si](C)(C)O[C@@H](CC(=O)O)C(F)(F)F.
What is the InChIKey of (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutanoic acid?
The InChIKey is BGJDPFGQRMYAEE-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H19F3O3Si/c1-9(2,3)17(4,5)16-7(6-8(14)15)10(11,12)13/h7H,6H2,1-5H3,(H,14,15)/t7-/m0/s1.
What are the key properties of (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutanoic acid?
(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutanoic acid has a molecular weight of 272.34 g/mol, XLogP of 3.41, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutanoic acid is sourced from PubChem (CID 163274361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).