C19H16Cl3F3O7 — CID 163274363
1-O-[2-oxo-2-(2,2,2-trichloroethoxy)ethyl] 4-O-[3-[4-(trifluoromethyl)phenyl]oxetan-3-yl] 2-methylidenebutanedioate (PubChem CID 163274363) has the molecular formula C19H16Cl3F3O7 and a molecular weight of 519.68 g/mol. Its IUPAC name is 1-O-[2-oxo-2-(2,2,2-trichloroethoxy)ethyl] 4-O-[3-[4-(trifluoromethyl)phenyl]oxetan-3-yl] 2-methylidenebutanedioate.
| Compound Name | 1-O-[2-oxo-2-(2,2,2-trichloroethoxy)ethyl] 4-O-[3-[4-(trifluoromethyl)phenyl]oxetan-3-yl] 2-methylidenebutanedioate |
|---|---|
| PubChem CID | 163274363 |
| Molecular Formula | C19H16Cl3F3O7 |
| Molecular Weight | 519.68 g/mol |
| Exact Mass | 517.99 |
| IUPAC Name | 1-O-[2-oxo-2-(2,2,2-trichloroethoxy)ethyl] 4-O-[3-[4-(trifluoromethyl)phenyl]oxetan-3-yl] 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)OC1(c2ccc(C(F)(F)F)cc2)COC1)C(=O)OCC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C19H16Cl3F3O7/c1-11(16(28)30-7-15(27)31-10-18(20,21)22)6-14(26)32-17(8-29-9-17)12-2-4-13(5-3-12)19(23,24)25/h2-5H,1,6-10H2 |
| InChIKey | ZLKSBQGDCSVROF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.68 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|