About 6-chloro-5-methoxy-4-methylpyrrolo[2,1-f][1,2,4]triazine;ethane
6-chloro-5-methoxy-4-methylpyrrolo[2,1-f][1,2,4]triazine;ethane (PubChem CID 163274616) has the molecular formula C10H14ClN3O
and a molecular weight of 227.69 g/mol. Its IUPAC name is 6-chloro-5-methoxy-4-methylpyrrolo[2,1-f][1,2,4]triazine;ethane.
Molecular Properties
| Compound Name | 6-chloro-5-methoxy-4-methylpyrrolo[2,1-f][1,2,4]triazine;ethane |
| PubChem CID | 163274616 |
| Molecular Formula | C10H14ClN3O |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 6-chloro-5-methoxy-4-methylpyrrolo[2,1-f][1,2,4]triazine;ethane |
| SMILES | CC.COc1c(Cl)cn2ncnc(C)c12 |
| InChI | InChI=1S/C8H8ClN3O.C2H6/c1-5-7-8(13-2)6(9)3-12(7)11-4-10-5;1-2/h3-4H,1-2H3;1-2H3 |
| InChIKey | YQNUYOZSUOOYOH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-chloro-5-methoxy-4-methylpyrrolo[2,1-f][1,2,4]triazine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-5-methoxy-4-methylpyrrolo[2,1-f][1,2,4]triazine;ethane?
The IUPAC name of 6-chloro-5-methoxy-4-methylpyrrolo[2,1-f][1,2,4]triazine;ethane (CID 163274616) is 6-chloro-5-methoxy-4-methylpyrrolo[2,1-f][1,2,4]triazine;ethane.
What is the SMILES notation for 6-chloro-5-methoxy-4-methylpyrrolo[2,1-f][1,2,4]triazine;ethane?
The canonical SMILES for 6-chloro-5-methoxy-4-methylpyrrolo[2,1-f][1,2,4]triazine;ethane is CC.COc1c(Cl)cn2ncnc(C)c12.
What is the InChIKey of 6-chloro-5-methoxy-4-methylpyrrolo[2,1-f][1,2,4]triazine;ethane?
The InChIKey is YQNUYOZSUOOYOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClN3O.C2H6/c1-5-7-8(13-2)6(9)3-12(7)11-4-10-5;1-2/h3-4H,1-2H3;1-2H3.
What are the key properties of 6-chloro-5-methoxy-4-methylpyrrolo[2,1-f][1,2,4]triazine;ethane?
6-chloro-5-methoxy-4-methylpyrrolo[2,1-f][1,2,4]triazine;ethane has a molecular weight of 227.69 g/mol, XLogP of 2.73, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-5-methoxy-4-methylpyrrolo[2,1-f][1,2,4]triazine;ethane is sourced from PubChem (CID 163274616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).