C17H22ClF3N6O2S — CID 163275119
7-chloro-5-methyl-4-[6-[sulfamoyl(4,4,4-trifluorobutyl)amino]-2-azaspiro[3.3]heptan-2-yl]pyrrolo[2,1-f][1,2,4]triazine (PubChem CID 163275119) has the molecular formula C17H22ClF3N6O2S and a molecular weight of 466.92 g/mol. Its IUPAC name is 7-chloro-5-methyl-4-[6-[sulfamoyl(4,4,4-trifluorobutyl)amino]-2-azaspiro[3.3]heptan-2-yl]pyrrolo[2,1-f][1,2,4]triazine.
| Compound Name | 7-chloro-5-methyl-4-[6-[sulfamoyl(4,4,4-trifluorobutyl)amino]-2-azaspiro[3.3]heptan-2-yl]pyrrolo[2,1-f][1,2,4]triazine |
|---|---|
| PubChem CID | 163275119 |
| Molecular Formula | C17H22ClF3N6O2S |
| Molecular Weight | 466.92 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | 7-chloro-5-methyl-4-[6-[sulfamoyl(4,4,4-trifluorobutyl)amino]-2-azaspiro[3.3]heptan-2-yl]pyrrolo[2,1-f][1,2,4]triazine |
| SMILES | Cc1cc(Cl)n2ncnc(N3CC4(CC(N(CCCC(F)(F)F)S(N)(=O)=O)C4)C3)c12 |
| InChI | InChI=1S/C17H22ClF3N6O2S/c1-11-5-13(18)27-14(11)15(23-10-24-27)25-8-16(9-25)6-12(7-16)26(30(22,28)29)4-2-3-17(19,20)21/h5,10,12H,2-4,6-9H2,1H3,(H2,22,28,29) |
| InChIKey | WVURCYAFIODBDF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 96.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.92 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |