About ethane;6-[methyl(sulfamoyl)amino]-2-azaspiro[3.3]heptane
ethane;6-[methyl(sulfamoyl)amino]-2-azaspiro[3.3]heptane (PubChem CID 163275222) has the molecular formula C9H21N3O2S
and a molecular weight of 235.35 g/mol. Its IUPAC name is ethane;6-[methyl(sulfamoyl)amino]-2-azaspiro[3.3]heptane.
Molecular Properties
| Compound Name | ethane;6-[methyl(sulfamoyl)amino]-2-azaspiro[3.3]heptane |
| PubChem CID | 163275222 |
| Molecular Formula | C9H21N3O2S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | ethane;6-[methyl(sulfamoyl)amino]-2-azaspiro[3.3]heptane |
| SMILES | CC.CN(C1CC2(CNC2)C1)S(N)(=O)=O |
| InChI | InChI=1S/C7H15N3O2S.C2H6/c1-10(13(8,11)12)6-2-7(3-6)4-9-5-7;1-2/h6,9H,2-5H2,1H3,(H2,8,11,12);1-2H3 |
| InChIKey | UGCGQUPTTRQILD-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;6-[methyl(sulfamoyl)amino]-2-azaspiro[3.3]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-[methyl(sulfamoyl)amino]-2-azaspiro[3.3]heptane?
The IUPAC name of ethane;6-[methyl(sulfamoyl)amino]-2-azaspiro[3.3]heptane (CID 163275222) is ethane;6-[methyl(sulfamoyl)amino]-2-azaspiro[3.3]heptane.
What is the SMILES notation for ethane;6-[methyl(sulfamoyl)amino]-2-azaspiro[3.3]heptane?
The canonical SMILES for ethane;6-[methyl(sulfamoyl)amino]-2-azaspiro[3.3]heptane is CC.CN(C1CC2(CNC2)C1)S(N)(=O)=O.
What is the InChIKey of ethane;6-[methyl(sulfamoyl)amino]-2-azaspiro[3.3]heptane?
The InChIKey is UGCGQUPTTRQILD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3O2S.C2H6/c1-10(13(8,11)12)6-2-7(3-6)4-9-5-7;1-2/h6,9H,2-5H2,1H3,(H2,8,11,12);1-2H3.
What are the key properties of ethane;6-[methyl(sulfamoyl)amino]-2-azaspiro[3.3]heptane?
ethane;6-[methyl(sulfamoyl)amino]-2-azaspiro[3.3]heptane has a molecular weight of 235.35 g/mol, XLogP of -0.10, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-[methyl(sulfamoyl)amino]-2-azaspiro[3.3]heptane is sourced from PubChem (CID 163275222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).