C12H14N2O2 — CID 163275362
ethane;6-methyl-[1,3]dioxolo[4,5-h]quinazoline (PubChem CID 163275362) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is ethane;6-methyl-[1,3]dioxolo[4,5-h]quinazoline.
| Compound Name | ethane;6-methyl-[1,3]dioxolo[4,5-h]quinazoline |
|---|---|
| PubChem CID | 163275362 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | ethane;6-methyl-[1,3]dioxolo[4,5-h]quinazoline |
| SMILES | CC.Cc1ncnc2c3c(ccc12)OCO3 |
| InChI | InChI=1S/C10H8N2O2.C2H6/c1-6-7-2-3-8-10(14-5-13-8)9(7)12-4-11-6;1-2/h2-4H,5H2,1H3;1-2H3 |
| InChIKey | CMMHYVMFEUUEPQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |