C8H14F3N3O4S — CID 163275614
[3-[2-(sulfamoylmethylamino)ethyl]azetidin-1-yl] 2,2,2-trifluoroacetate (PubChem CID 163275614) has the molecular formula C8H14F3N3O4S and a molecular weight of 305.28 g/mol. Its IUPAC name is [3-[2-(sulfamoylmethylamino)ethyl]azetidin-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [3-[2-(sulfamoylmethylamino)ethyl]azetidin-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 163275614 |
| Molecular Formula | C8H14F3N3O4S |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | [3-[2-(sulfamoylmethylamino)ethyl]azetidin-1-yl] 2,2,2-trifluoroacetate |
| SMILES | NS(=O)(=O)CNCCC1CN(OC(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C8H14F3N3O4S/c9-8(10,11)7(15)18-14-3-6(4-14)1-2-13-5-19(12,16)17/h6,13H,1-5H2,(H2,12,16,17) |
| InChIKey | KCHDBHVCUOXOHS-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|