C26H27F3N4O4 — CID 163275771
N-[(1S)-1-cyclopentyl-2-[4-[2-methyl-1-oxido-4-(trifluoromethyl)pyridin-1-ium-3-yl]anilino]-2-oxoethyl]-3-ethyl-1,2-oxazole-4-carboxamide (PubChem CID 163275771) has the molecular formula C26H27F3N4O4 and a molecular weight of 516.52 g/mol. Its IUPAC name is N-[(1S)-1-cyclopentyl-2-[4-[2-methyl-1-oxido-4-(trifluoromethyl)pyridin-1-ium-3-yl]anilino]-2-oxoethyl]-3-ethyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[(1S)-1-cyclopentyl-2-[4-[2-methyl-1-oxido-4-(trifluoromethyl)pyridin-1-ium-3-yl]anilino]-2-oxoethyl]-3-ethyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 163275771 |
| Molecular Formula | C26H27F3N4O4 |
| Molecular Weight | 516.52 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | N-[(1S)-1-cyclopentyl-2-[4-[2-methyl-1-oxido-4-(trifluoromethyl)pyridin-1-ium-3-yl]anilino]-2-oxoethyl]-3-ethyl-1,2-oxazole-4-carboxamide |
| SMILES | CCc1nocc1C(=O)N[C@H](C(=O)Nc1ccc(-c2c(C(F)(F)F)cc[n+]([O-])c2C)cc1)C1CCCC1 |
| InChI | InChI=1S/C26H27F3N4O4/c1-3-21-19(14-37-32-21)24(34)31-23(17-6-4-5-7-17)25(35)30-18-10-8-16(9-11-18)22-15(2)33(36)13-12-20(22)26(27,28)29/h8-14,17,23H,3-7H2,1-2H3,(H,30,35)(H,31,34)/t23-/m0/s1 |
| InChIKey | FUFCNAAOWQFDJY-QHCPKHFHSA-N |
| XLogP | 4.79 |
| TPSA | 111.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|