C26H28ClF2N5O3 — CID 163275832
N-[(1S)-2-[4-(4-chloro-2-methyl-1-oxidopyridin-1-ium-3-yl)anilino]-1-(4,4-difluorocyclohexyl)-2-oxoethyl]-2-ethylpyrazole-3-carboxamide (PubChem CID 163275832) has the molecular formula C26H28ClF2N5O3 and a molecular weight of 531.99 g/mol. Its IUPAC name is N-[(1S)-2-[4-(4-chloro-2-methyl-1-oxidopyridin-1-ium-3-yl)anilino]-1-(4,4-difluorocyclohexyl)-2-oxoethyl]-2-ethylpyrazole-3-carboxamide.
| Compound Name | N-[(1S)-2-[4-(4-chloro-2-methyl-1-oxidopyridin-1-ium-3-yl)anilino]-1-(4,4-difluorocyclohexyl)-2-oxoethyl]-2-ethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 163275832 |
| Molecular Formula | C26H28ClF2N5O3 |
| Molecular Weight | 531.99 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | N-[(1S)-2-[4-(4-chloro-2-methyl-1-oxidopyridin-1-ium-3-yl)anilino]-1-(4,4-difluorocyclohexyl)-2-oxoethyl]-2-ethylpyrazole-3-carboxamide |
| SMILES | CCn1nccc1C(=O)N[C@H](C(=O)Nc1ccc(-c2c(Cl)cc[n+]([O-])c2C)cc1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C26H28ClF2N5O3/c1-3-33-21(10-14-30-33)24(35)32-23(18-8-12-26(28,29)13-9-18)25(36)31-19-6-4-17(5-7-19)22-16(2)34(37)15-11-20(22)27/h4-7,10-11,14-15,18,23H,3,8-9,12-13H2,1-2H3,(H,31,36)(H,32,35)/t23-/m0/s1 |
| InChIKey | LGCZEAKEWPKQQU-QHCPKHFHSA-N |
| XLogP | 4.73 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.99 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|