About 7-(5-chloropyrimidin-2-yl)oxy-1-(4,4,4-trifluorobutyl)indole
7-(5-chloropyrimidin-2-yl)oxy-1-(4,4,4-trifluorobutyl)indole (PubChem CID 163275949) has the molecular formula C16H13ClF3N3O
and a molecular weight of 355.75 g/mol. Its IUPAC name is 7-(5-chloropyrimidin-2-yl)oxy-1-(4,4,4-trifluorobutyl)indole.
Molecular Properties
| Compound Name | 7-(5-chloropyrimidin-2-yl)oxy-1-(4,4,4-trifluorobutyl)indole |
| PubChem CID | 163275949 |
| Molecular Formula | C16H13ClF3N3O |
| Molecular Weight | 355.75 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 7-(5-chloropyrimidin-2-yl)oxy-1-(4,4,4-trifluorobutyl)indole |
| SMILES | FC(F)(F)CCCn1ccc2cccc(Oc3ncc(Cl)cn3)c21 |
| InChI | InChI=1S/C16H13ClF3N3O/c17-12-9-21-15(22-10-12)24-13-4-1-3-11-5-8-23(14(11)13)7-2-6-16(18,19)20/h1,3-5,8-10H,2,6-7H2 |
| InChIKey | GNPOKKOKSKKLMY-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.75 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(5-chloropyrimidin-2-yl)oxy-1-(4,4,4-trifluorobutyl)indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(5-chloropyrimidin-2-yl)oxy-1-(4,4,4-trifluorobutyl)indole?
The IUPAC name of 7-(5-chloropyrimidin-2-yl)oxy-1-(4,4,4-trifluorobutyl)indole (CID 163275949) is 7-(5-chloropyrimidin-2-yl)oxy-1-(4,4,4-trifluorobutyl)indole.
What is the SMILES notation for 7-(5-chloropyrimidin-2-yl)oxy-1-(4,4,4-trifluorobutyl)indole?
The canonical SMILES for 7-(5-chloropyrimidin-2-yl)oxy-1-(4,4,4-trifluorobutyl)indole is FC(F)(F)CCCn1ccc2cccc(Oc3ncc(Cl)cn3)c21.
What is the InChIKey of 7-(5-chloropyrimidin-2-yl)oxy-1-(4,4,4-trifluorobutyl)indole?
The InChIKey is GNPOKKOKSKKLMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClF3N3O/c17-12-9-21-15(22-10-12)24-13-4-1-3-11-5-8-23(14(11)13)7-2-6-16(18,19)20/h1,3-5,8-10H,2,6-7H2.
What are the key properties of 7-(5-chloropyrimidin-2-yl)oxy-1-(4,4,4-trifluorobutyl)indole?
7-(5-chloropyrimidin-2-yl)oxy-1-(4,4,4-trifluorobutyl)indole has a molecular weight of 355.75 g/mol, XLogP of 5.22, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(5-chloropyrimidin-2-yl)oxy-1-(4,4,4-trifluorobutyl)indole is sourced from PubChem (CID 163275949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).