About ethane;4-ethenylhex-5-enyl-ethoxy-methoxy-methyl-λ4-sulfane
ethane;4-ethenylhex-5-enyl-ethoxy-methoxy-methyl-λ4-sulfane (PubChem CID 163276255) has the molecular formula C14H30O2S
and a molecular weight of 262.46 g/mol. Its IUPAC name is ethane;4-ethenylhex-5-enyl-ethoxy-methoxy-methyl-λ4-sulfane.
Molecular Properties
| Compound Name | ethane;4-ethenylhex-5-enyl-ethoxy-methoxy-methyl-λ4-sulfane |
| PubChem CID | 163276255 |
| Molecular Formula | C14H30O2S |
| Molecular Weight | 262.46 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | ethane;4-ethenylhex-5-enyl-ethoxy-methoxy-methyl-λ4-sulfane |
| SMILES | C=CC(C=C)CCCS(C)(OC)OCC.CC |
| InChI | InChI=1S/C12H24O2S.C2H6/c1-6-12(7-2)10-9-11-15(5,13-4)14-8-3;1-2/h6-7,12H,1-2,8-11H2,3-5H3;1-2H3 |
| InChIKey | KSIZICBZYFIYQK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-ethenylhex-5-enyl-ethoxy-methoxy-methyl-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-ethenylhex-5-enyl-ethoxy-methoxy-methyl-λ4-sulfane?
The IUPAC name of ethane;4-ethenylhex-5-enyl-ethoxy-methoxy-methyl-λ4-sulfane (CID 163276255) is ethane;4-ethenylhex-5-enyl-ethoxy-methoxy-methyl-λ4-sulfane.
What is the SMILES notation for ethane;4-ethenylhex-5-enyl-ethoxy-methoxy-methyl-λ4-sulfane?
The canonical SMILES for ethane;4-ethenylhex-5-enyl-ethoxy-methoxy-methyl-λ4-sulfane is C=CC(C=C)CCCS(C)(OC)OCC.CC.
What is the InChIKey of ethane;4-ethenylhex-5-enyl-ethoxy-methoxy-methyl-λ4-sulfane?
The InChIKey is KSIZICBZYFIYQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2S.C2H6/c1-6-12(7-2)10-9-11-15(5,13-4)14-8-3;1-2/h6-7,12H,1-2,8-11H2,3-5H3;1-2H3.
What are the key properties of ethane;4-ethenylhex-5-enyl-ethoxy-methoxy-methyl-λ4-sulfane?
ethane;4-ethenylhex-5-enyl-ethoxy-methoxy-methyl-λ4-sulfane has a molecular weight of 262.46 g/mol, XLogP of 4.73, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-ethenylhex-5-enyl-ethoxy-methoxy-methyl-λ4-sulfane is sourced from PubChem (CID 163276255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).