C11H17NO5 — CID 163276648
ethyl 4-[(3R)-3-methylmorpholin-4-yl]-2,4-dioxobutanoate (PubChem CID 163276648) has the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. Its IUPAC name is ethyl 4-[(3R)-3-methylmorpholin-4-yl]-2,4-dioxobutanoate.
| Compound Name | ethyl 4-[(3R)-3-methylmorpholin-4-yl]-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 163276648 |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | ethyl 4-[(3R)-3-methylmorpholin-4-yl]-2,4-dioxobutanoate |
| SMILES | CCOC(=O)C(=O)CC(=O)N1CCOC[C@H]1C |
| InChI | InChI=1S/C11H17NO5/c1-3-17-11(15)9(13)6-10(14)12-4-5-16-7-8(12)2/h8H,3-7H2,1-2H3/t8-/m1/s1 |
| InChIKey | ULINPSZXSMQTHR-MRVPVSSYSA-N |
| XLogP | -0.24 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|