About 1-[2-[(E)-prop-1-enyl]cyclopropyl]ethane-1,2-diimine
1-[2-[(E)-prop-1-enyl]cyclopropyl]ethane-1,2-diimine (PubChem CID 163277434) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is 1-[2-[(E)-prop-1-enyl]cyclopropyl]ethane-1,2-diimine.
Molecular Properties
| Compound Name | 1-[2-[(E)-prop-1-enyl]cyclopropyl]ethane-1,2-diimine |
| PubChem CID | 163277434 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 1-[2-[(E)-prop-1-enyl]cyclopropyl]ethane-1,2-diimine |
| SMILES | [H]/N=C(\C=N\[H])C1CC1/C=C/C |
| InChI | InChI=1S/C8H12N2/c1-2-3-6-4-7(6)8(10)5-9/h2-3,5-7,9-10H,4H2,1H3/b3-2+,9-5+,10-8+ |
| InChIKey | REHRLGHMSRPRKP-FTSUTJIBSA-N |
| XLogP | 1.87 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[(E)-prop-1-enyl]cyclopropyl]ethane-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(E)-prop-1-enyl]cyclopropyl]ethane-1,2-diimine?
The IUPAC name of 1-[2-[(E)-prop-1-enyl]cyclopropyl]ethane-1,2-diimine (CID 163277434) is 1-[2-[(E)-prop-1-enyl]cyclopropyl]ethane-1,2-diimine.
What is the SMILES notation for 1-[2-[(E)-prop-1-enyl]cyclopropyl]ethane-1,2-diimine?
The canonical SMILES for 1-[2-[(E)-prop-1-enyl]cyclopropyl]ethane-1,2-diimine is [H]/N=C(\C=N\[H])C1CC1/C=C/C.
What is the InChIKey of 1-[2-[(E)-prop-1-enyl]cyclopropyl]ethane-1,2-diimine?
The InChIKey is REHRLGHMSRPRKP-FTSUTJIBSA-N. The full InChI is InChI=1S/C8H12N2/c1-2-3-6-4-7(6)8(10)5-9/h2-3,5-7,9-10H,4H2,1H3/b3-2+,9-5+,10-8+.
What are the key properties of 1-[2-[(E)-prop-1-enyl]cyclopropyl]ethane-1,2-diimine?
1-[2-[(E)-prop-1-enyl]cyclopropyl]ethane-1,2-diimine has a molecular weight of 136.20 g/mol, XLogP of 1.87, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(E)-prop-1-enyl]cyclopropyl]ethane-1,2-diimine is sourced from PubChem (CID 163277434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).