C7H12F3N — CID 163278127
(E)-1,7,7-trifluorohept-1-en-4-amine (PubChem CID 163278127) has the molecular formula C7H12F3N and a molecular weight of 167.17 g/mol. Its IUPAC name is (E)-1,7,7-trifluorohept-1-en-4-amine.
| Compound Name | (E)-1,7,7-trifluorohept-1-en-4-amine |
|---|---|
| PubChem CID | 163278127 |
| Molecular Formula | C7H12F3N |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | (E)-1,7,7-trifluorohept-1-en-4-amine |
| SMILES | NC(C/C=C/F)CCC(F)F |
| InChI | InChI=1S/C7H12F3N/c8-5-1-2-6(11)3-4-7(9)10/h1,5-7H,2-4,11H2/b5-1+ |
| InChIKey | JIOBYUJHKAMZQN-ORCRQEGFSA-N |
| XLogP | 2.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |