C28H37F2N7O2 — CID 163278140
1-[(1R)-1-[5-(8-but-3-enoxy-[1,2,4]triazolo[1,5-a]pyrazin-6-yl)-6-methyl-3-pyridinyl]ethyl]-3-[(4S)-7,7-difluorooct-1-en-4-yl]-1-ethylurea (PubChem CID 163278140) has the molecular formula C28H37F2N7O2 and a molecular weight of 541.65 g/mol. Its IUPAC name is 1-[(1R)-1-[5-(8-but-3-enoxy-[1,2,4]triazolo[1,5-a]pyrazin-6-yl)-6-methyl-3-pyridinyl]ethyl]-3-[(4S)-7,7-difluorooct-1-en-4-yl]-1-ethylurea.
| Compound Name | 1-[(1R)-1-[5-(8-but-3-enoxy-[1,2,4]triazolo[1,5-a]pyrazin-6-yl)-6-methyl-3-pyridinyl]ethyl]-3-[(4S)-7,7-difluorooct-1-en-4-yl]-1-ethylurea |
|---|---|
| PubChem CID | 163278140 |
| Molecular Formula | C28H37F2N7O2 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.30 |
| IUPAC Name | 1-[(1R)-1-[5-(8-but-3-enoxy-[1,2,4]triazolo[1,5-a]pyrazin-6-yl)-6-methyl-3-pyridinyl]ethyl]-3-[(4S)-7,7-difluorooct-1-en-4-yl]-1-ethylurea |
| SMILES | C=CCCOc1nc(-c2cc([C@@H](C)N(CC)C(=O)N[C@H](CC=C)CCC(C)(F)F)cnc2C)cn2ncnc12 |
| InChI | InChI=1S/C28H37F2N7O2/c1-7-10-14-39-26-25-32-18-33-37(25)17-24(35-26)23-15-21(16-31-19(23)4)20(5)36(9-3)27(38)34-22(11-8-2)12-13-28(6,29)30/h7-8,15-18,20,22H,1-2,9-14H2,3-6H3,(H,34,38)/t20-,22-/m1/s1 |
| InChIKey | BDZNGSPXUWQXQF-IFMALSPDSA-N |
| XLogP | 5.92 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|