C15H21N5O — CID 163278150
(E)-4-(4-but-3-enoxyimidazo[2,1-f][1,2,4]triazin-2-yl)-N-ethylbut-3-en-1-amine (PubChem CID 163278150) has the molecular formula C15H21N5O and a molecular weight of 287.37 g/mol. Its IUPAC name is (E)-4-(4-but-3-enoxyimidazo[2,1-f][1,2,4]triazin-2-yl)-N-ethylbut-3-en-1-amine.
| Compound Name | (E)-4-(4-but-3-enoxyimidazo[2,1-f][1,2,4]triazin-2-yl)-N-ethylbut-3-en-1-amine |
|---|---|
| PubChem CID | 163278150 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | (E)-4-(4-but-3-enoxyimidazo[2,1-f][1,2,4]triazin-2-yl)-N-ethylbut-3-en-1-amine |
| SMILES | C=CCCOc1nc(/C=C/CCNCC)nn2ccnc12 |
| InChI | InChI=1S/C15H21N5O/c1-3-5-12-21-15-14-17-10-11-20(14)19-13(18-15)8-6-7-9-16-4-2/h3,6,8,10-11,16H,1,4-5,7,9,12H2,2H3/b8-6+ |
| InChIKey | XFYBKWMGJYQDHZ-SOFGYWHQSA-N |
| XLogP | 2.09 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|