C29H48F3N5O2 — CID 163278165
1-ethyl-1-propan-2-yl-3-[(Z)-1,1,1-trifluoro-8-[2-(1-methylimidazol-2-yl)-2-prop-1-en-2-yliminoethoxy]oct-5-en-4-yl]urea;bis(prop-1-ene) (PubChem CID 163278165) has the molecular formula C29H48F3N5O2 and a molecular weight of 555.73 g/mol. Its IUPAC name is 1-ethyl-1-propan-2-yl-3-[(Z)-1,1,1-trifluoro-8-[2-(1-methylimidazol-2-yl)-2-prop-1-en-2-yliminoethoxy]oct-5-en-4-yl]urea;bis(prop-1-ene).
| Compound Name | 1-ethyl-1-propan-2-yl-3-[(Z)-1,1,1-trifluoro-8-[2-(1-methylimidazol-2-yl)-2-prop-1-en-2-yliminoethoxy]oct-5-en-4-yl]urea;bis(prop-1-ene) |
|---|---|
| PubChem CID | 163278165 |
| Molecular Formula | C29H48F3N5O2 |
| Molecular Weight | 555.73 g/mol |
| Exact Mass | 555.38 |
| IUPAC Name | 1-ethyl-1-propan-2-yl-3-[(Z)-1,1,1-trifluoro-8-[2-(1-methylimidazol-2-yl)-2-prop-1-en-2-yliminoethoxy]oct-5-en-4-yl]urea;bis(prop-1-ene) |
| SMILES | C=C(C)/N=C(\COCC/C=C\C(CCC(F)(F)F)NC(=O)N(CC)C(C)C)c1nccn1C.C=CC.C=CC |
| InChI | InChI=1S/C23H36F3N5O2.2C3H6/c1-7-31(18(4)5)22(32)29-19(11-12-23(24,25)26)10-8-9-15-33-16-20(28-17(2)3)21-27-13-14-30(21)6;2*1-3-2/h8,10,13-14,18-19H,2,7,9,11-12,15-16H2,1,3-6H3,(H,29,32);2*3H,1H2,2H3/b10-8-,28-20+;; |
| InChIKey | VIBPUKHYRIIBGB-MRHGEWIDSA-N |
| XLogP | 7.24 |
| TPSA | 71.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.73 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|