About N-butoxysulfanyl-6,6,6-trifluoro-1-(2-methoxyethoxy)hexan-3-amine
N-butoxysulfanyl-6,6,6-trifluoro-1-(2-methoxyethoxy)hexan-3-amine (PubChem CID 163278184) has the molecular formula C13H26F3NO3S
and a molecular weight of 333.42 g/mol. Its IUPAC name is N-butoxysulfanyl-6,6,6-trifluoro-1-(2-methoxyethoxy)hexan-3-amine.
Molecular Properties
| Compound Name | N-butoxysulfanyl-6,6,6-trifluoro-1-(2-methoxyethoxy)hexan-3-amine |
| PubChem CID | 163278184 |
| Molecular Formula | C13H26F3NO3S |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | N-butoxysulfanyl-6,6,6-trifluoro-1-(2-methoxyethoxy)hexan-3-amine |
| SMILES | CCCCOSNC(CCOCCOC)CCC(F)(F)F |
| InChI | InChI=1S/C13H26F3NO3S/c1-3-4-8-20-21-17-12(5-7-13(14,15)16)6-9-19-11-10-18-2/h12,17H,3-11H2,1-2H3 |
| InChIKey | CLZSOGRYNYCURZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-butoxysulfanyl-6,6,6-trifluoro-1-(2-methoxyethoxy)hexan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butoxysulfanyl-6,6,6-trifluoro-1-(2-methoxyethoxy)hexan-3-amine?
The IUPAC name of N-butoxysulfanyl-6,6,6-trifluoro-1-(2-methoxyethoxy)hexan-3-amine (CID 163278184) is N-butoxysulfanyl-6,6,6-trifluoro-1-(2-methoxyethoxy)hexan-3-amine.
What is the SMILES notation for N-butoxysulfanyl-6,6,6-trifluoro-1-(2-methoxyethoxy)hexan-3-amine?
The canonical SMILES for N-butoxysulfanyl-6,6,6-trifluoro-1-(2-methoxyethoxy)hexan-3-amine is CCCCOSNC(CCOCCOC)CCC(F)(F)F.
What is the InChIKey of N-butoxysulfanyl-6,6,6-trifluoro-1-(2-methoxyethoxy)hexan-3-amine?
The InChIKey is CLZSOGRYNYCURZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26F3NO3S/c1-3-4-8-20-21-17-12(5-7-13(14,15)16)6-9-19-11-10-18-2/h12,17H,3-11H2,1-2H3.
What are the key properties of N-butoxysulfanyl-6,6,6-trifluoro-1-(2-methoxyethoxy)hexan-3-amine?
N-butoxysulfanyl-6,6,6-trifluoro-1-(2-methoxyethoxy)hexan-3-amine has a molecular weight of 333.42 g/mol, XLogP of 3.72, 14 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-butoxysulfanyl-6,6,6-trifluoro-1-(2-methoxyethoxy)hexan-3-amine is sourced from PubChem (CID 163278184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).