C25H30F3N7O3 — CID 163278223
(7R,11S,13E)-8-ethyl-3-methoxy-7-methyl-11-(3,3,3-trifluoropropyl)-17-oxa-4,8,10,20,23,25,26-heptazatetracyclo[16.6.1.12,6.019,23]hexacosa-1(24),2(26),3,5,13,18(25),19,21-octaen-9-one (PubChem CID 163278223) has the molecular formula C25H30F3N7O3 and a molecular weight of 533.56 g/mol. Its IUPAC name is (7R,11S,13E)-8-ethyl-3-methoxy-7-methyl-11-(3,3,3-trifluoropropyl)-17-oxa-4,8,10,20,23,25,26-heptazatetracyclo[16.6.1.12,6.019,23]hexacosa-1(24),2(26),3,5,13,18(25),19,21-octaen-9-one.
| Compound Name | (7R,11S,13E)-8-ethyl-3-methoxy-7-methyl-11-(3,3,3-trifluoropropyl)-17-oxa-4,8,10,20,23,25,26-heptazatetracyclo[16.6.1.12,6.019,23]hexacosa-1(24),2(26),3,5,13,18(25),19,21-octaen-9-one |
|---|---|
| PubChem CID | 163278223 |
| Molecular Formula | C25H30F3N7O3 |
| Molecular Weight | 533.56 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | (7R,11S,13E)-8-ethyl-3-methoxy-7-methyl-11-(3,3,3-trifluoropropyl)-17-oxa-4,8,10,20,23,25,26-heptazatetracyclo[16.6.1.12,6.019,23]hexacosa-1(24),2(26),3,5,13,18(25),19,21-octaen-9-one |
| SMILES | CCN1C(=O)N[C@@H](CCC(F)(F)F)C/C=C/CCOc2nc(cn3ccnc23)-c2nc(cnc2OC)[C@H]1C |
| InChI | InChI=1S/C25H30F3N7O3/c1-4-35-16(2)18-14-30-22(37-3)20(32-18)19-15-34-12-11-29-21(34)23(33-19)38-13-7-5-6-8-17(31-24(35)36)9-10-25(26,27)28/h5-6,11-12,14-17H,4,7-10,13H2,1-3H3,(H,31,36)/b6-5+/t16-,17-/m1/s1 |
| InChIKey | ACZPZOGJOCTOEE-SDKBWNRFSA-N |
| XLogP | 4.73 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|