C23H31F4N7O3 — CID 163278243
(3S)-1-[2-[[6-[2-[1-(ethylamino)ethyl]-3-fluoro-5-methoxy-4-pyridinyl]-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]oxy]ethoxy]-6,6,6-trifluorohexan-3-amine (PubChem CID 163278243) has the molecular formula C23H31F4N7O3 and a molecular weight of 529.54 g/mol. Its IUPAC name is (3S)-1-[2-[[6-[2-[1-(ethylamino)ethyl]-3-fluoro-5-methoxy-4-pyridinyl]-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]oxy]ethoxy]-6,6,6-trifluorohexan-3-amine.
| Compound Name | (3S)-1-[2-[[6-[2-[1-(ethylamino)ethyl]-3-fluoro-5-methoxy-4-pyridinyl]-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]oxy]ethoxy]-6,6,6-trifluorohexan-3-amine |
|---|---|
| PubChem CID | 163278243 |
| Molecular Formula | C23H31F4N7O3 |
| Molecular Weight | 529.54 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | (3S)-1-[2-[[6-[2-[1-(ethylamino)ethyl]-3-fluoro-5-methoxy-4-pyridinyl]-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]oxy]ethoxy]-6,6,6-trifluorohexan-3-amine |
| SMILES | CCNC(C)c1ncc(OC)c(-c2cn3ncnc3c(OCCOCC[C@@H](N)CCC(F)(F)F)n2)c1F |
| InChI | InChI=1S/C23H31F4N7O3/c1-4-29-14(2)20-19(24)18(17(35-3)11-30-20)16-12-34-21(31-13-32-34)22(33-16)37-10-9-36-8-6-15(28)5-7-23(25,26)27/h11-15,29H,4-10,28H2,1-3H3/t14?,15-/m0/s1 |
| InChIKey | FXGBXNDOKFRXAM-LOACHALJSA-N |
| XLogP | 3.46 |
| TPSA | 121.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.54 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|