C27H39F3N2O3Si — CID 163278252
tert-butyl N-[2-[2-[tert-butyl(diphenyl)silyl]oxyethyl-methylamino]-3,3,3-trifluoropropyl]carbamate (PubChem CID 163278252) has the molecular formula C27H39F3N2O3Si and a molecular weight of 524.70 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[tert-butyl(diphenyl)silyl]oxyethyl-methylamino]-3,3,3-trifluoropropyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[tert-butyl(diphenyl)silyl]oxyethyl-methylamino]-3,3,3-trifluoropropyl]carbamate |
|---|---|
| PubChem CID | 163278252 |
| Molecular Formula | C27H39F3N2O3Si |
| Molecular Weight | 524.70 g/mol |
| Exact Mass | 524.27 |
| IUPAC Name | tert-butyl N-[2-[2-[tert-butyl(diphenyl)silyl]oxyethyl-methylamino]-3,3,3-trifluoropropyl]carbamate |
| SMILES | CN(CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(CNC(=O)OC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C27H39F3N2O3Si/c1-25(2,3)35-24(33)31-20-23(27(28,29)30)32(7)18-19-34-36(26(4,5)6,21-14-10-8-11-15-21)22-16-12-9-13-17-22/h8-17,23H,18-20H2,1-7H3,(H,31,33) |
| InChIKey | DNKDZGLORFWXQD-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.70 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|