About tert-butyl N-(6,6,6-trifluorohex-1-en-3-yl)carbamate
tert-butyl N-(6,6,6-trifluorohex-1-en-3-yl)carbamate (PubChem CID 163278327) has the molecular formula C11H18F3NO2
and a molecular weight of 253.26 g/mol. Its IUPAC name is tert-butyl N-(6,6,6-trifluorohex-1-en-3-yl)carbamate.
Molecular Properties
| Compound Name | tert-butyl N-(6,6,6-trifluorohex-1-en-3-yl)carbamate |
| PubChem CID | 163278327 |
| Molecular Formula | C11H18F3NO2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | tert-butyl N-(6,6,6-trifluorohex-1-en-3-yl)carbamate |
| SMILES | C=CC(CCC(F)(F)F)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H18F3NO2/c1-5-8(6-7-11(12,13)14)15-9(16)17-10(2,3)4/h5,8H,1,6-7H2,2-4H3,(H,15,16) |
| InChIKey | WLIUENKPWJIXPH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-(6,6,6-trifluorohex-1-en-3-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(6,6,6-trifluorohex-1-en-3-yl)carbamate?
The IUPAC name of tert-butyl N-(6,6,6-trifluorohex-1-en-3-yl)carbamate (CID 163278327) is tert-butyl N-(6,6,6-trifluorohex-1-en-3-yl)carbamate.
What is the SMILES notation for tert-butyl N-(6,6,6-trifluorohex-1-en-3-yl)carbamate?
The canonical SMILES for tert-butyl N-(6,6,6-trifluorohex-1-en-3-yl)carbamate is C=CC(CCC(F)(F)F)NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-(6,6,6-trifluorohex-1-en-3-yl)carbamate?
The InChIKey is WLIUENKPWJIXPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F3NO2/c1-5-8(6-7-11(12,13)14)15-9(16)17-10(2,3)4/h5,8H,1,6-7H2,2-4H3,(H,15,16).
What are the key properties of tert-butyl N-(6,6,6-trifluorohex-1-en-3-yl)carbamate?
tert-butyl N-(6,6,6-trifluorohex-1-en-3-yl)carbamate has a molecular weight of 253.26 g/mol, XLogP of 3.41, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(6,6,6-trifluorohex-1-en-3-yl)carbamate is sourced from PubChem (CID 163278327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).