C22H30F3N7O2 — CID 163278368
1-[2-[[6-[2-[(1R)-1-(ethylamino)ethyl]-4-pyridinyl]-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]oxy]ethoxy]-6,6,6-trifluorohexan-3-amine (PubChem CID 163278368) has the molecular formula C22H30F3N7O2 and a molecular weight of 481.52 g/mol. Its IUPAC name is 1-[2-[[6-[2-[(1R)-1-(ethylamino)ethyl]-4-pyridinyl]-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]oxy]ethoxy]-6,6,6-trifluorohexan-3-amine.
| Compound Name | 1-[2-[[6-[2-[(1R)-1-(ethylamino)ethyl]-4-pyridinyl]-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]oxy]ethoxy]-6,6,6-trifluorohexan-3-amine |
|---|---|
| PubChem CID | 163278368 |
| Molecular Formula | C22H30F3N7O2 |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | 1-[2-[[6-[2-[(1R)-1-(ethylamino)ethyl]-4-pyridinyl]-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]oxy]ethoxy]-6,6,6-trifluorohexan-3-amine |
| SMILES | CCN[C@H](C)c1cc(-c2cn3ncnc3c(OCCOCCC(N)CCC(F)(F)F)n2)ccn1 |
| InChI | InChI=1S/C22H30F3N7O2/c1-3-27-15(2)18-12-16(5-8-28-18)19-13-32-20(29-14-30-32)21(31-19)34-11-10-33-9-6-17(26)4-7-22(23,24)25/h5,8,12-15,17,27H,3-4,6-7,9-11,26H2,1-2H3/t15-,17?/m1/s1 |
| InChIKey | MMPCFEBZRNKYND-LDCVWXEPSA-N |
| XLogP | 3.31 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|