C28H39F3N2O4Si — CID 163278453
tert-butyl N-[2-[3-[tert-butyl(diphenyl)silyl]oxypropanoyl-methylamino]-3,3,3-trifluoropropyl]carbamate (PubChem CID 163278453) has the molecular formula C28H39F3N2O4Si and a molecular weight of 552.71 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[tert-butyl(diphenyl)silyl]oxypropanoyl-methylamino]-3,3,3-trifluoropropyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[tert-butyl(diphenyl)silyl]oxypropanoyl-methylamino]-3,3,3-trifluoropropyl]carbamate |
|---|---|
| PubChem CID | 163278453 |
| Molecular Formula | C28H39F3N2O4Si |
| Molecular Weight | 552.71 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | tert-butyl N-[2-[3-[tert-butyl(diphenyl)silyl]oxypropanoyl-methylamino]-3,3,3-trifluoropropyl]carbamate |
| SMILES | CN(C(=O)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(CNC(=O)OC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C28H39F3N2O4Si/c1-26(2,3)37-25(35)32-20-23(28(29,30)31)33(7)24(34)18-19-36-38(27(4,5)6,21-14-10-8-11-15-21)22-16-12-9-13-17-22/h8-17,23H,18-20H2,1-7H3,(H,32,35) |
| InChIKey | KQEQUFKCJNXPHJ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.71 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|