C28H41F3N2O3Si — CID 163278767
tert-butyl N-[2-[3-[tert-butyl(diphenyl)silyl]oxypropyl-methylamino]-3,3,3-trifluoropropyl]carbamate (PubChem CID 163278767) has the molecular formula C28H41F3N2O3Si and a molecular weight of 538.73 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[tert-butyl(diphenyl)silyl]oxypropyl-methylamino]-3,3,3-trifluoropropyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[tert-butyl(diphenyl)silyl]oxypropyl-methylamino]-3,3,3-trifluoropropyl]carbamate |
|---|---|
| PubChem CID | 163278767 |
| Molecular Formula | C28H41F3N2O3Si |
| Molecular Weight | 538.73 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | tert-butyl N-[2-[3-[tert-butyl(diphenyl)silyl]oxypropyl-methylamino]-3,3,3-trifluoropropyl]carbamate |
| SMILES | CN(CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(CNC(=O)OC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C28H41F3N2O3Si/c1-26(2,3)36-25(34)32-21-24(28(29,30)31)33(7)19-14-20-35-37(27(4,5)6,22-15-10-8-11-16-22)23-17-12-9-13-18-23/h8-13,15-18,24H,14,19-21H2,1-7H3,(H,32,34) |
| InChIKey | OCBADNMAPDNOJN-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.73 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|