About (3S)-1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-6,6,6-trifluorohexan-3-amine
(3S)-1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-6,6,6-trifluorohexan-3-amine (PubChem CID 163279087) has the molecular formula C14H30F3NO2Si
and a molecular weight of 329.48 g/mol. Its IUPAC name is (3S)-1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-6,6,6-trifluorohexan-3-amine.
Molecular Properties
| Compound Name | (3S)-1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-6,6,6-trifluorohexan-3-amine |
| PubChem CID | 163279087 |
| Molecular Formula | C14H30F3NO2Si |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | (3S)-1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-6,6,6-trifluorohexan-3-amine |
| SMILES | CC(C)(C)[Si](C)(C)OCCOCC[C@@H](N)CCC(F)(F)F |
| InChI | InChI=1S/C14H30F3NO2Si/c1-13(2,3)21(4,5)20-11-10-19-9-7-12(18)6-8-14(15,16)17/h12H,6-11,18H2,1-5H3/t12-/m0/s1 |
| InChIKey | XDEWHISVMIDAIA-LBPRGKRZSA-N |
| XLogP | 4.08 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3S)-1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-6,6,6-trifluorohexan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-6,6,6-trifluorohexan-3-amine?
The IUPAC name of (3S)-1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-6,6,6-trifluorohexan-3-amine (CID 163279087) is (3S)-1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-6,6,6-trifluorohexan-3-amine.
What is the SMILES notation for (3S)-1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-6,6,6-trifluorohexan-3-amine?
The canonical SMILES for (3S)-1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-6,6,6-trifluorohexan-3-amine is CC(C)(C)[Si](C)(C)OCCOCC[C@@H](N)CCC(F)(F)F.
What is the InChIKey of (3S)-1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-6,6,6-trifluorohexan-3-amine?
The InChIKey is XDEWHISVMIDAIA-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H30F3NO2Si/c1-13(2,3)21(4,5)20-11-10-19-9-7-12(18)6-8-14(15,16)17/h12H,6-11,18H2,1-5H3/t12-/m0/s1.
What are the key properties of (3S)-1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-6,6,6-trifluorohexan-3-amine?
(3S)-1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-6,6,6-trifluorohexan-3-amine has a molecular weight of 329.48 g/mol, XLogP of 4.08, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-6,6,6-trifluorohexan-3-amine is sourced from PubChem (CID 163279087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).