C33H33F7N6O — CID 163280582
2-N-[3-[(dimethylamino)methyl]phenyl]-4-N-[2-fluoro-5-(methylamino)phenyl]-5-[4-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine;prop-2-enal;3,3,3-trifluoroprop-1-ene (PubChem CID 163280582) has the molecular formula C33H33F7N6O and a molecular weight of 662.65 g/mol. Its IUPAC name is 2-N-[3-[(dimethylamino)methyl]phenyl]-4-N-[2-fluoro-5-(methylamino)phenyl]-5-[4-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine;prop-2-enal;3,3,3-trifluoroprop-1-ene.
| Compound Name | 2-N-[3-[(dimethylamino)methyl]phenyl]-4-N-[2-fluoro-5-(methylamino)phenyl]-5-[4-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine;prop-2-enal;3,3,3-trifluoroprop-1-ene |
|---|---|
| PubChem CID | 163280582 |
| Molecular Formula | C33H33F7N6O |
| Molecular Weight | 662.65 g/mol |
| Exact Mass | 662.26 |
| IUPAC Name | 2-N-[3-[(dimethylamino)methyl]phenyl]-4-N-[2-fluoro-5-(methylamino)phenyl]-5-[4-(trifluoromethyl)phenyl]pyrimidine-2,4-diamine;prop-2-enal;3,3,3-trifluoroprop-1-ene |
| SMILES | C=CC(F)(F)F.C=CC=O.CNc1ccc(F)c(Nc2nc(Nc3cccc(CN(C)C)c3)ncc2-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C27H26F4N6.C3H3F3.C3H4O/c1-32-20-11-12-23(28)24(14-20)35-25-22(18-7-9-19(10-8-18)27(29,30)31)15-33-26(36-25)34-21-6-4-5-17(13-21)16-37(2)3;1-2-3(4,5)6;1-2-3-4/h4-15,32H,16H2,1-3H3,(H2,33,34,35,36);2H,1H2;2-3H,1H2 |
| InChIKey | REZRZSBQBQXTMT-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.65 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|