C13H23N3O2 — CID 163281582
6-methyl-8-(2-methylbutyl)-1,2,3,6,9,9a-hexahydropyrazino[1,2-a]pyrimidine-4,7-dione (PubChem CID 163281582) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 6-methyl-8-(2-methylbutyl)-1,2,3,6,9,9a-hexahydropyrazino[1,2-a]pyrimidine-4,7-dione.
| Compound Name | 6-methyl-8-(2-methylbutyl)-1,2,3,6,9,9a-hexahydropyrazino[1,2-a]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 163281582 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 6-methyl-8-(2-methylbutyl)-1,2,3,6,9,9a-hexahydropyrazino[1,2-a]pyrimidine-4,7-dione |
| SMILES | CCC(C)CN1CC2NCCC(=O)N2C(C)C1=O |
| InChI | InChI=1S/C13H23N3O2/c1-4-9(2)7-15-8-11-14-6-5-12(17)16(11)10(3)13(15)18/h9-11,14H,4-8H2,1-3H3 |
| InChIKey | TVRMWEVNWUEBCO-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |