C17H23NO4 — CID 163281906
(4aR)-4a-(2,3-dihydroxy-6-methylphenyl)-8a-hydroxy-1-methyl-2,3,4,5,7,8-hexahydro-1H-isoquinolin-6-one (PubChem CID 163281906) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is (4aR)-4a-(2,3-dihydroxy-6-methylphenyl)-8a-hydroxy-1-methyl-2,3,4,5,7,8-hexahydro-1H-isoquinolin-6-one.
| Compound Name | (4aR)-4a-(2,3-dihydroxy-6-methylphenyl)-8a-hydroxy-1-methyl-2,3,4,5,7,8-hexahydro-1H-isoquinolin-6-one |
|---|---|
| PubChem CID | 163281906 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | (4aR)-4a-(2,3-dihydroxy-6-methylphenyl)-8a-hydroxy-1-methyl-2,3,4,5,7,8-hexahydro-1H-isoquinolin-6-one |
| SMILES | Cc1ccc(O)c(O)c1[C@]12CCNC(C)C1(O)CCC(=O)C2 |
| InChI | InChI=1S/C17H23NO4/c1-10-3-4-13(20)15(21)14(10)16-7-8-18-11(2)17(16,22)6-5-12(19)9-16/h3-4,11,18,20-22H,5-9H2,1-2H3/t11?,16-,17?/m1/s1 |
| InChIKey | MXFGJSSGRJLGCZ-PCHQZIJMSA-N |
| XLogP | 1.51 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|