About 6-bromo-3-(4-methoxyphenyl)-1-methyl-1,2-dihydrobenzo[e]indole
6-bromo-3-(4-methoxyphenyl)-1-methyl-1,2-dihydrobenzo[e]indole (PubChem CID 163282260) has the molecular formula C20H18BrNO
and a molecular weight of 368.27 g/mol. Its IUPAC name is 6-bromo-3-(4-methoxyphenyl)-1-methyl-1,2-dihydrobenzo[e]indole.
Molecular Properties
| Compound Name | 6-bromo-3-(4-methoxyphenyl)-1-methyl-1,2-dihydrobenzo[e]indole |
| PubChem CID | 163282260 |
| Molecular Formula | C20H18BrNO |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 6-bromo-3-(4-methoxyphenyl)-1-methyl-1,2-dihydrobenzo[e]indole |
| SMILES | COc1ccc(N2CC(C)c3c2ccc2c(Br)cccc32)cc1 |
| InChI | InChI=1S/C20H18BrNO/c1-13-12-22(14-6-8-15(23-2)9-7-14)19-11-10-16-17(20(13)19)4-3-5-18(16)21/h3-11,13H,12H2,1-2H3 |
| InChIKey | ATQMMKDXIBPCDC-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-3-(4-methoxyphenyl)-1-methyl-1,2-dihydrobenzo[e]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-(4-methoxyphenyl)-1-methyl-1,2-dihydrobenzo[e]indole?
The IUPAC name of 6-bromo-3-(4-methoxyphenyl)-1-methyl-1,2-dihydrobenzo[e]indole (CID 163282260) is 6-bromo-3-(4-methoxyphenyl)-1-methyl-1,2-dihydrobenzo[e]indole.
What is the SMILES notation for 6-bromo-3-(4-methoxyphenyl)-1-methyl-1,2-dihydrobenzo[e]indole?
The canonical SMILES for 6-bromo-3-(4-methoxyphenyl)-1-methyl-1,2-dihydrobenzo[e]indole is COc1ccc(N2CC(C)c3c2ccc2c(Br)cccc32)cc1.
What is the InChIKey of 6-bromo-3-(4-methoxyphenyl)-1-methyl-1,2-dihydrobenzo[e]indole?
The InChIKey is ATQMMKDXIBPCDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18BrNO/c1-13-12-22(14-6-8-15(23-2)9-7-14)19-11-10-16-17(20(13)19)4-3-5-18(16)21/h3-11,13H,12H2,1-2H3.
What are the key properties of 6-bromo-3-(4-methoxyphenyl)-1-methyl-1,2-dihydrobenzo[e]indole?
6-bromo-3-(4-methoxyphenyl)-1-methyl-1,2-dihydrobenzo[e]indole has a molecular weight of 368.27 g/mol, XLogP of 5.87, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-(4-methoxyphenyl)-1-methyl-1,2-dihydrobenzo[e]indole is sourced from PubChem (CID 163282260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).