C15H18N2 — CID 163282267
N,N,1-trimethyl-2,3-dihydro-1H-benzo[e]indol-6-amine (PubChem CID 163282267) has the molecular formula C15H18N2 and a molecular weight of 226.32 g/mol. Its IUPAC name is N,N,1-trimethyl-2,3-dihydro-1H-benzo[e]indol-6-amine.
| Compound Name | N,N,1-trimethyl-2,3-dihydro-1H-benzo[e]indol-6-amine |
|---|---|
| PubChem CID | 163282267 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | N,N,1-trimethyl-2,3-dihydro-1H-benzo[e]indol-6-amine |
| SMILES | CC1CNc2ccc3c(N(C)C)cccc3c21 |
| InChI | InChI=1S/C15H18N2/c1-10-9-16-13-8-7-11-12(15(10)13)5-4-6-14(11)17(2)3/h4-8,10,16H,9H2,1-3H3 |
| InChIKey | OLLCXINABQLHNQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |