C10H8BrF2NO2 — CID 163283121
[(5R)-3-(4-bromo-3,5-difluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol (PubChem CID 163283121) has the molecular formula C10H8BrF2NO2 and a molecular weight of 292.08 g/mol. Its IUPAC name is [(5R)-3-(4-bromo-3,5-difluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol.
| Compound Name | [(5R)-3-(4-bromo-3,5-difluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol |
|---|---|
| PubChem CID | 163283121 |
| Molecular Formula | C10H8BrF2NO2 |
| Molecular Weight | 292.08 g/mol |
| Exact Mass | 290.97 |
| IUPAC Name | [(5R)-3-(4-bromo-3,5-difluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methanol |
| SMILES | OC[C@H]1CC(c2cc(F)c(Br)c(F)c2)=NO1 |
| InChI | InChI=1S/C10H8BrF2NO2/c11-10-7(12)1-5(2-8(10)13)9-3-6(4-15)16-14-9/h1-2,6,15H,3-4H2/t6-/m1/s1 |
| InChIKey | UUTRGEOCZVVJDE-ZCFIWIBFSA-N |
| XLogP | 2.21 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.08 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|