C20H18F2N6O3 — CID 163283142
1-(3-aminophenyl)-3-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 163283142) has the molecular formula C20H18F2N6O3 and a molecular weight of 428.40 g/mol. Its IUPAC name is 1-(3-aminophenyl)-3-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 1-(3-aminophenyl)-3-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 163283142 |
| Molecular Formula | C20H18F2N6O3 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 1-(3-aminophenyl)-3-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)C(=O)N(Cc2ccc(-c3nnc(C(F)F)o3)cn2)C(=O)N1c1cccc(N)c1 |
| InChI | InChI=1S/C20H18F2N6O3/c1-20(2)18(29)27(19(30)28(20)14-5-3-4-12(23)8-14)10-13-7-6-11(9-24-13)16-25-26-17(31-16)15(21)22/h3-9,15H,10,23H2,1-2H3 |
| InChIKey | JHNGRBVZCSYCNF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|