C18H13F2N5O3 — CID 163283196
3-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methyl]-1-phenylimidazolidine-2,4-dione (PubChem CID 163283196) has the molecular formula C18H13F2N5O3 and a molecular weight of 385.33 g/mol. Its IUPAC name is 3-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methyl]-1-phenylimidazolidine-2,4-dione.
| Compound Name | 3-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methyl]-1-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 163283196 |
| Molecular Formula | C18H13F2N5O3 |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 3-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methyl]-1-phenylimidazolidine-2,4-dione |
| SMILES | O=C1CN(c2ccccc2)C(=O)N1Cc1ccc(-c2nnc(C(F)F)o2)cn1 |
| InChI | InChI=1S/C18H13F2N5O3/c19-15(20)17-23-22-16(28-17)11-6-7-12(21-8-11)9-25-14(26)10-24(18(25)27)13-4-2-1-3-5-13/h1-8,15H,9-10H2 |
| InChIKey | HLPZQOZQRLVDGO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 92.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|