C14H14F3N3O4S — CID 163283632
[3-[5-methoxy-2-(2,2,2-trifluoroethoxymethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea (PubChem CID 163283632) has the molecular formula C14H14F3N3O4S and a molecular weight of 377.34 g/mol. Its IUPAC name is [3-[5-methoxy-2-(2,2,2-trifluoroethoxymethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea.
| Compound Name | [3-[5-methoxy-2-(2,2,2-trifluoroethoxymethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea |
|---|---|
| PubChem CID | 163283632 |
| Molecular Formula | C14H14F3N3O4S |
| Molecular Weight | 377.34 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | [3-[5-methoxy-2-(2,2,2-trifluoroethoxymethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea |
| SMILES | COc1ccc(COCC(F)(F)F)c(N2C(=O)CSC2=NC(N)=O)c1 |
| InChI | InChI=1S/C14H14F3N3O4S/c1-23-9-3-2-8(5-24-7-14(15,16)17)10(4-9)20-11(21)6-25-13(20)19-12(18)22/h2-4H,5-7H2,1H3,(H2,18,22) |
| InChIKey | FBEYUGXMAFINKV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|